About 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine
6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine (PubChem CID 174778488) has the molecular formula C22H17BrN2O
and a molecular weight of 405.30 g/mol. Its IUPAC name is 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine.
Molecular Properties
| Compound Name | 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine |
| PubChem CID | 174778488 |
| Molecular Formula | C22H17BrN2O |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine |
| SMILES | O=C1CCCc2c1ccc1c2cc(Br)c2ccccc21.c1cnccn1 |
| InChI | InChI=1S/C18H13BrO.C4H4N2/c19-17-10-16-12-6-3-7-18(20)15(12)9-8-13(16)11-4-1-2-5-14(11)17;1-2-6-4-3-5-1/h1-2,4-5,8-10H,3,6-7H2;1-4H |
| InChIKey | SAJSMNRKOGTUBZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine?
The IUPAC name of 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine (CID 174778488) is 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine.
What is the SMILES notation for 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine?
The canonical SMILES for 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine is O=C1CCCc2c1ccc1c2cc(Br)c2ccccc21.c1cnccn1.
What is the InChIKey of 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine?
The InChIKey is SAJSMNRKOGTUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrO.C4H4N2/c19-17-10-16-12-6-3-7-18(20)15(12)9-8-13(16)11-4-1-2-5-14(11)17;1-2-6-4-3-5-1/h1-2,4-5,8-10H,3,6-7H2;1-4H.
What are the key properties of 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine?
6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine has a molecular weight of 405.30 g/mol, XLogP of 5.75, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,4-dihydro-2H-chrysen-1-one;pyrazine is sourced from PubChem (CID 174778488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).