About 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane
6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane (PubChem CID 174778513) has the molecular formula C13H26O2Si2
and a molecular weight of 270.52 g/mol. Its IUPAC name is 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane.
Molecular Properties
| Compound Name | 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane |
| PubChem CID | 174778513 |
| Molecular Formula | C13H26O2Si2 |
| Molecular Weight | 270.52 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane |
| SMILES | CCC1CC2CC1C1=C2O1.C[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C9H12O.C4H14OSi2/c1-2-5-3-6-4-7(5)9-8(6)10-9;1-6-5-7(2,3)4/h5-7H,2-4H2,1H3;6H2,1-4H3 |
| InChIKey | JMKVCYWMNVTEKN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane?
The IUPAC name of 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane (CID 174778513) is 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane.
What is the SMILES notation for 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane?
The canonical SMILES for 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane is CCC1CC2CC1C1=C2O1.C[SiH2]O[Si](C)(C)C.
What is the InChIKey of 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane?
The InChIKey is JMKVCYWMNVTEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C4H14OSi2/c1-2-5-3-6-4-7(5)9-8(6)10-9;1-6-5-7(2,3)4/h5-7H,2-4H2,1H3;6H2,1-4H3.
What are the key properties of 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane?
6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane has a molecular weight of 270.52 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene;trimethyl(methylsilyloxy)silane is sourced from PubChem (CID 174778513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).