About phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine
phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine (PubChem CID 174779210) has the molecular formula C18H18N6O
and a molecular weight of 334.38 g/mol. Its IUPAC name is phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine |
| PubChem CID | 174779210 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine |
| SMILES | C=CCn1nnnc1C(=NO)c1ccccc1.[H]/N=C/c1ccccc1 |
| InChI | InChI=1S/C11H11N5O.C7H7N/c1-2-8-16-11(12-14-15-16)10(13-17)9-6-4-3-5-7-9;8-6-7-4-2-1-3-5-7/h2-7,17H,1,8H2;1-6,8H/b;8-6+ |
| InChIKey | KTPMHLMTYJZBEA-ZQGZPJDTSA-N |
| XLogP | 2.77 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine?
The IUPAC name of phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine (CID 174779210) is phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine.
What is the SMILES notation for phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine?
The canonical SMILES for phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine is C=CCn1nnnc1C(=NO)c1ccccc1.[H]/N=C/c1ccccc1.
What is the InChIKey of phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine?
The InChIKey is KTPMHLMTYJZBEA-ZQGZPJDTSA-N. The full InChI is InChI=1S/C11H11N5O.C7H7N/c1-2-8-16-11(12-14-15-16)10(13-17)9-6-4-3-5-7-9;8-6-7-4-2-1-3-5-7/h2-7,17H,1,8H2;1-6,8H/b;8-6+.
What are the key properties of phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine?
phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine has a molecular weight of 334.38 g/mol, XLogP of 2.77, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanimine;N-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]hydroxylamine is sourced from PubChem (CID 174779210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).