About [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate
[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate (PubChem CID 174779481) has the molecular formula C18H13Cl2NO5
and a molecular weight of 394.21 g/mol. Its IUPAC name is [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate.
Molecular Properties
| Compound Name | [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate |
| PubChem CID | 174779481 |
| Molecular Formula | C18H13Cl2NO5 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate |
| SMILES | CC(=O)Oc1c(O)c2ccc(Oc3cc(Cl)ccc3Cl)cc2n(C)c1=O |
| InChI | InChI=1S/C18H13Cl2NO5/c1-9(22)25-17-16(23)12-5-4-11(8-14(12)21(2)18(17)24)26-15-7-10(19)3-6-13(15)20/h3-8,23H,1-2H3 |
| InChIKey | MYBRJBWUTXPICE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate?
The IUPAC name of [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate (CID 174779481) is [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate.
What is the SMILES notation for [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate?
The canonical SMILES for [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate is CC(=O)Oc1c(O)c2ccc(Oc3cc(Cl)ccc3Cl)cc2n(C)c1=O.
What is the InChIKey of [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate?
The InChIKey is MYBRJBWUTXPICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2NO5/c1-9(22)25-17-16(23)12-5-4-11(8-14(12)21(2)18(17)24)26-15-7-10(19)3-6-13(15)20/h3-8,23H,1-2H3.
What are the key properties of [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate?
[7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate has a molecular weight of 394.21 g/mol, XLogP of 4.27, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2,5-dichlorophenoxy)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl] acetate is sourced from PubChem (CID 174779481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).