About 2-methylpropanoyl 2-(benzenesulfonyl)butanoate
2-methylpropanoyl 2-(benzenesulfonyl)butanoate (PubChem CID 174779709) has the molecular formula C14H18O5S
and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-methylpropanoyl 2-(benzenesulfonyl)butanoate.
Molecular Properties
| Compound Name | 2-methylpropanoyl 2-(benzenesulfonyl)butanoate |
| PubChem CID | 174779709 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-methylpropanoyl 2-(benzenesulfonyl)butanoate |
| SMILES | CCC(C(=O)OC(=O)C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O5S/c1-4-12(14(16)19-13(15)10(2)3)20(17,18)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3 |
| InChIKey | DSGOKUZRELIIOU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanoyl 2-(benzenesulfonyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanoyl 2-(benzenesulfonyl)butanoate?
The IUPAC name of 2-methylpropanoyl 2-(benzenesulfonyl)butanoate (CID 174779709) is 2-methylpropanoyl 2-(benzenesulfonyl)butanoate.
What is the SMILES notation for 2-methylpropanoyl 2-(benzenesulfonyl)butanoate?
The canonical SMILES for 2-methylpropanoyl 2-(benzenesulfonyl)butanoate is CCC(C(=O)OC(=O)C(C)C)S(=O)(=O)c1ccccc1.
What is the InChIKey of 2-methylpropanoyl 2-(benzenesulfonyl)butanoate?
The InChIKey is DSGOKUZRELIIOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5S/c1-4-12(14(16)19-13(15)10(2)3)20(17,18)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3.
What are the key properties of 2-methylpropanoyl 2-(benzenesulfonyl)butanoate?
2-methylpropanoyl 2-(benzenesulfonyl)butanoate has a molecular weight of 298.36 g/mol, XLogP of 1.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanoyl 2-(benzenesulfonyl)butanoate is sourced from PubChem (CID 174779709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).