2-methylpropanoyl 2-(benzenesulfonyl)butanoate

C14H18O5S — CID 174779709

IUPAC2-methylpropanoyl 2-(benzenesulfonyl)butanoate
SMILESCCC(C(=O)OC(=O)C(C)C)S(=O)(=O)c1ccccc1
InChIInChI=1S/C14H18O5S/c1-4-12(14(16)19-13(15)10(2)3)20(17,18)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3
InChIKeyDSGOKUZRELIIOU-UHFFFAOYSA-N
MW298.36 g/mol
LogP1.96
Rot. Bonds5

About 2-methylpropanoyl 2-(benzenesulfonyl)butanoate

2-methylpropanoyl 2-(benzenesulfonyl)butanoate (PubChem CID 174779709) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-methylpropanoyl 2-(benzenesulfonyl)butanoate.

Molecular Properties

Compound Name2-methylpropanoyl 2-(benzenesulfonyl)butanoate
PubChem CID174779709
Molecular FormulaC14H18O5S
Molecular Weight298.36 g/mol
Exact Mass298.09
IUPAC Name2-methylpropanoyl 2-(benzenesulfonyl)butanoate
SMILESCCC(C(=O)OC(=O)C(C)C)S(=O)(=O)c1ccccc1
InChIInChI=1S/C14H18O5S/c1-4-12(14(16)19-13(15)10(2)3)20(17,18)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3
InChIKeyDSGOKUZRELIIOU-UHFFFAOYSA-N
XLogP1.96
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.36
LogP ≤ 51.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-methylpropanoyl 2-(benzenesulfonyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpropanoyl 2-(benzenesulfonyl)butanoate?
The IUPAC name of 2-methylpropanoyl 2-(benzenesulfonyl)butanoate (CID 174779709) is 2-methylpropanoyl 2-(benzenesulfonyl)butanoate.
What is the SMILES notation for 2-methylpropanoyl 2-(benzenesulfonyl)butanoate?
The canonical SMILES for 2-methylpropanoyl 2-(benzenesulfonyl)butanoate is CCC(C(=O)OC(=O)C(C)C)S(=O)(=O)c1ccccc1.
What is the InChIKey of 2-methylpropanoyl 2-(benzenesulfonyl)butanoate?
The InChIKey is DSGOKUZRELIIOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5S/c1-4-12(14(16)19-13(15)10(2)3)20(17,18)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3.
What are the key properties of 2-methylpropanoyl 2-(benzenesulfonyl)butanoate?
2-methylpropanoyl 2-(benzenesulfonyl)butanoate has a molecular weight of 298.36 g/mol, XLogP of 1.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanoyl 2-(benzenesulfonyl)butanoate is sourced from PubChem (CID 174779709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).