C26H55NO3 — CID 174779715
N,N-dimethylhenicosan-3-amine;2-hydroxypropanoic acid (PubChem CID 174779715) has the molecular formula C26H55NO3 and a molecular weight of 429.73 g/mol. Its IUPAC name is N,N-dimethylhenicosan-3-amine;2-hydroxypropanoic acid.
| Compound Name | N,N-dimethylhenicosan-3-amine;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 174779715 |
| Molecular Formula | C26H55NO3 |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 429.42 |
| IUPAC Name | N,N-dimethylhenicosan-3-amine;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.CCCCCCCCCCCCCCCCCCC(CC)N(C)C |
| InChI | InChI=1S/C23H49N.C3H6O3/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(6-2)24(3)4;1-2(4)3(5)6/h23H,5-22H2,1-4H3;2,4H,1H3,(H,5,6) |
| InChIKey | ISBDKFRIYXKAFS-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|