C16H17NO6 — CID 174780555
(8S)-8-amino-10-benzyl-1,6-dioxacycloundecane-2,5,7,11-tetrone (PubChem CID 174780555) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is (8S)-8-amino-10-benzyl-1,6-dioxacycloundecane-2,5,7,11-tetrone.
| Compound Name | (8S)-8-amino-10-benzyl-1,6-dioxacycloundecane-2,5,7,11-tetrone |
|---|---|
| PubChem CID | 174780555 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (8S)-8-amino-10-benzyl-1,6-dioxacycloundecane-2,5,7,11-tetrone |
| SMILES | N[C@H]1CC(Cc2ccccc2)C(=O)OC(=O)CCC(=O)OC1=O |
| InChI | InChI=1S/C16H17NO6/c17-12-9-11(8-10-4-2-1-3-5-10)15(20)22-13(18)6-7-14(19)23-16(12)21/h1-5,11-12H,6-9,17H2/t11?,12-/m0/s1 |
| InChIKey | LSOCAXFRAHNNKO-KIYNQFGBSA-N |
| XLogP | 0.50 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|