About N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide
N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide (PubChem CID 174781071) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide.
Molecular Properties
| Compound Name | N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide |
| PubChem CID | 174781071 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide |
| SMILES | O=CNc1nccc2cc[nH]c12 |
| InChI | InChI=1S/C8H7N3O/c12-5-11-8-7-6(1-3-9-7)2-4-10-8/h1-5,9H,(H,10,11,12) |
| InChIKey | KWJJEXIXRKSIDP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide?
The IUPAC name of N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide (CID 174781071) is N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide.
What is the SMILES notation for N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide?
The canonical SMILES for N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide is O=CNc1nccc2cc[nH]c12.
What is the InChIKey of N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide?
The InChIKey is KWJJEXIXRKSIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c12-5-11-8-7-6(1-3-9-7)2-4-10-8/h1-5,9H,(H,10,11,12).
What are the key properties of N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide?
N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide has a molecular weight of 161.16 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-pyrrolo[2,3-c]pyridin-7-yl)formamide is sourced from PubChem (CID 174781071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).