About 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine
5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine (PubChem CID 174781441) has the molecular formula C16H9F3N4
and a molecular weight of 314.27 g/mol. Its IUPAC name is 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine |
| PubChem CID | 174781441 |
| Molecular Formula | C16H9F3N4 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine |
| SMILES | FC(F)(F)c1ccc2c(-c3c[nH]c4ncccc34)ccnc2n1 |
| InChI | InChI=1S/C16H9F3N4/c17-16(18,19)13-4-3-11-9(5-7-21-15(11)23-13)12-8-22-14-10(12)2-1-6-20-14/h1-8H,(H,20,22) |
| InChIKey | MKVNTRJUPPJNOO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine?
The IUPAC name of 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine (CID 174781441) is 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine.
What is the SMILES notation for 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine?
The canonical SMILES for 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine is FC(F)(F)c1ccc2c(-c3c[nH]c4ncccc34)ccnc2n1.
What is the InChIKey of 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine?
The InChIKey is MKVNTRJUPPJNOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9F3N4/c17-16(18,19)13-4-3-11-9(5-7-21-15(11)23-13)12-8-22-14-10(12)2-1-6-20-14/h1-8H,(H,20,22).
What are the key properties of 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine?
5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine has a molecular weight of 314.27 g/mol, XLogP of 4.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-(trifluoromethyl)-1,8-naphthyridine is sourced from PubChem (CID 174781441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).