About CID 174782522
CID 174782522 (PubChem CID 174782522) has the molecular formula C2H5F2OSi
and a molecular weight of 111.14 g/mol.
Molecular Properties
| Compound Name | CID 174782522 |
| PubChem CID | 174782522 |
| Molecular Formula | C2H5F2OSi |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.01 |
| IUPAC Name | — |
| SMILES | FCC(F)O[SiH2] |
| InChI | InChI=1S/C2H5F2OSi/c3-1-2(4)5-6/h2H,1,6H2 |
| InChIKey | KIHDDSKTYNWUHL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174782522 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174782522?
The IUPAC name of CID 174782522 (CID 174782522) is not available.
What is the SMILES notation for CID 174782522?
The canonical SMILES for CID 174782522 is FCC(F)O[SiH2].
What is the InChIKey of CID 174782522?
The InChIKey is KIHDDSKTYNWUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5F2OSi/c3-1-2(4)5-6/h2H,1,6H2.
What are the key properties of CID 174782522?
CID 174782522 has a molecular weight of 111.14 g/mol, XLogP of -0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174782522 is sourced from PubChem (CID 174782522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).