C10H12O3 — CID 174782535
2-(1,3,5,6,7,7a-hexahydro-2-benzofuran-1-yl)-2-oxoacetaldehyde (PubChem CID 174782535) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(1,3,5,6,7,7a-hexahydro-2-benzofuran-1-yl)-2-oxoacetaldehyde.
| Compound Name | 2-(1,3,5,6,7,7a-hexahydro-2-benzofuran-1-yl)-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174782535 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(1,3,5,6,7,7a-hexahydro-2-benzofuran-1-yl)-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1OCC2=CCCCC21 |
| InChI | InChI=1S/C10H12O3/c11-5-9(12)10-8-4-2-1-3-7(8)6-13-10/h3,5,8,10H,1-2,4,6H2 |
| InChIKey | HHXQZQSJCFYETI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|