About 1-buta-1,3-dien-2-ylindazole
1-buta-1,3-dien-2-ylindazole (PubChem CID 174783141) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-ylindazole.
Molecular Properties
| Compound Name | 1-buta-1,3-dien-2-ylindazole |
| PubChem CID | 174783141 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1-buta-1,3-dien-2-ylindazole |
| SMILES | C=CC(=C)n1ncc2ccccc21 |
| InChI | InChI=1S/C11H10N2/c1-3-9(2)13-11-7-5-4-6-10(11)8-12-13/h3-8H,1-2H2 |
| InChIKey | URFHAMYDORJEKY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dien-2-ylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dien-2-ylindazole?
The IUPAC name of 1-buta-1,3-dien-2-ylindazole (CID 174783141) is 1-buta-1,3-dien-2-ylindazole.
What is the SMILES notation for 1-buta-1,3-dien-2-ylindazole?
The canonical SMILES for 1-buta-1,3-dien-2-ylindazole is C=CC(=C)n1ncc2ccccc21.
What is the InChIKey of 1-buta-1,3-dien-2-ylindazole?
The InChIKey is URFHAMYDORJEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-3-9(2)13-11-7-5-4-6-10(11)8-12-13/h3-8H,1-2H2.
What are the key properties of 1-buta-1,3-dien-2-ylindazole?
1-buta-1,3-dien-2-ylindazole has a molecular weight of 170.21 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dien-2-ylindazole is sourced from PubChem (CID 174783141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).