C39H29N3O5 — CID 174783250
3,5-dinitro-N-(1,2,3,4-tetrahydrochrysen-1-yl)benzamide;phenanthrene (PubChem CID 174783250) has the molecular formula C39H29N3O5 and a molecular weight of 619.68 g/mol. Its IUPAC name is 3,5-dinitro-N-(1,2,3,4-tetrahydrochrysen-1-yl)benzamide;phenanthrene.
| Compound Name | 3,5-dinitro-N-(1,2,3,4-tetrahydrochrysen-1-yl)benzamide;phenanthrene |
|---|---|
| PubChem CID | 174783250 |
| Molecular Formula | C39H29N3O5 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | 3,5-dinitro-N-(1,2,3,4-tetrahydrochrysen-1-yl)benzamide;phenanthrene |
| SMILES | O=C(NC1CCCc2c1ccc1c2ccc2ccccc21)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C25H19N3O5.C14H10/c29-25(16-12-17(27(30)31)14-18(13-16)28(32)33)26-24-7-3-6-20-22-9-8-15-4-1-2-5-19(15)21(22)10-11-23(20)24;1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-2,4-5,8-14,24H,3,6-7H2,(H,26,29);1-10H |
| InChIKey | UMVJYEGDQSUDIL-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|