C23H17ClN2O5 — CID 174783340
5-[(1S)-1-(3-chlorophenyl)-2-nitroethyl]-3,5-diphenyl-1,3-oxazolidine-2,4-dione (PubChem CID 174783340) has the molecular formula C23H17ClN2O5 and a molecular weight of 436.85 g/mol. Its IUPAC name is 5-[(1S)-1-(3-chlorophenyl)-2-nitroethyl]-3,5-diphenyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-[(1S)-1-(3-chlorophenyl)-2-nitroethyl]-3,5-diphenyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 174783340 |
| Molecular Formula | C23H17ClN2O5 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 5-[(1S)-1-(3-chlorophenyl)-2-nitroethyl]-3,5-diphenyl-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1OC(c2ccccc2)([C@H](C[N+](=O)[O-])c2cccc(Cl)c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H17ClN2O5/c24-18-11-7-8-16(14-18)20(15-25(29)30)23(17-9-3-1-4-10-17)21(27)26(22(28)31-23)19-12-5-2-6-13-19/h1-14,20H,15H2/t20-,23?/m1/s1 |
| InChIKey | RIMHFKKDJYWJJT-PPUHSXQSSA-N |
| XLogP | 4.78 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|