About 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one
4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one (PubChem CID 174783814) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one.
Molecular Properties
| Compound Name | 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one |
| PubChem CID | 174783814 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one |
| SMILES | NCc1ccc(-c2ccc(C(N)=O)c3[nH]ccc23)cc1.O=C1C=CN1 |
| InChI | InChI=1S/C16H15N3O.C3H3NO/c17-9-10-1-3-11(4-2-10)12-5-6-14(16(18)20)15-13(12)7-8-19-15;5-3-1-2-4-3/h1-8,19H,9,17H2,(H2,18,20);1-2H,(H,4,5) |
| InChIKey | UIWIRXWZBCOKFT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one?
The IUPAC name of 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one (CID 174783814) is 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one.
What is the SMILES notation for 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one?
The canonical SMILES for 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one is NCc1ccc(-c2ccc(C(N)=O)c3[nH]ccc23)cc1.O=C1C=CN1.
What is the InChIKey of 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one?
The InChIKey is UIWIRXWZBCOKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O.C3H3NO/c17-9-10-1-3-11(4-2-10)12-5-6-14(16(18)20)15-13(12)7-8-19-15;5-3-1-2-4-3/h1-8,19H,9,17H2,(H2,18,20);1-2H,(H,4,5).
What are the key properties of 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one?
4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one has a molecular weight of 334.38 g/mol, XLogP of 2.02, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(aminomethyl)phenyl]-1H-indole-7-carboxamide;1H-azet-2-one is sourced from PubChem (CID 174783814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).