About trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate
trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate (PubChem CID 174784133) has the molecular formula C13H26O5Si
and a molecular weight of 290.43 g/mol. Its IUPAC name is trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate.
Molecular Properties
| Compound Name | trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate |
| PubChem CID | 174784133 |
| Molecular Formula | C13H26O5Si |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate |
| SMILES | CCC(CC1CCC2OC2C1)O[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H26O5Si/c1-5-11(18-19(14-2,15-3)16-4)8-10-6-7-12-13(9-10)17-12/h10-13H,5-9H2,1-4H3 |
| InChIKey | SAJRQMHOZLIFKZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate?
The IUPAC name of trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate (CID 174784133) is trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate.
What is the SMILES notation for trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate?
The canonical SMILES for trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate is CCC(CC1CCC2OC2C1)O[Si](OC)(OC)OC.
What is the InChIKey of trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate?
The InChIKey is SAJRQMHOZLIFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5Si/c1-5-11(18-19(14-2,15-3)16-4)8-10-6-7-12-13(9-10)17-12/h10-13H,5-9H2,1-4H3.
What are the key properties of trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate?
trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate has a molecular weight of 290.43 g/mol, XLogP of 2.11, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl 1-(7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl silicate is sourced from PubChem (CID 174784133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).