C8H4BrF3O2 — CID 174784326
2-bromo-3,4,6-trifluoro-5-methoxybenzaldehyde (PubChem CID 174784326) has the molecular formula C8H4BrF3O2 and a molecular weight of 269.02 g/mol. Its IUPAC name is 2-bromo-3,4,6-trifluoro-5-methoxybenzaldehyde.
| Compound Name | 2-bromo-3,4,6-trifluoro-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 174784326 |
| Molecular Formula | C8H4BrF3O2 |
| Molecular Weight | 269.02 g/mol |
| Exact Mass | 267.93 |
| IUPAC Name | 2-bromo-3,4,6-trifluoro-5-methoxybenzaldehyde |
| SMILES | COc1c(F)c(F)c(Br)c(C=O)c1F |
| InChI | InChI=1S/C8H4BrF3O2/c1-14-8-5(10)3(2-13)4(9)6(11)7(8)12/h2H,1H3 |
| InChIKey | MXCCLLIEXKXFCT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.02 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|