About (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine
(4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine (PubChem CID 174784468) has the molecular formula C13H20BrNOS2
and a molecular weight of 350.35 g/mol. Its IUPAC name is (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine.
Molecular Properties
| Compound Name | (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine |
| PubChem CID | 174784468 |
| Molecular Formula | C13H20BrNOS2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.O=C(S)Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C7H5BrOS2.C6H15N/c8-5-1-3-6(4-2-5)11-7(9)10;1-4-7(5-2)6-3/h1-4H,(H,9,10);4-6H2,1-3H3 |
| InChIKey | NPMJQGGUBPGWDJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine?
The IUPAC name of (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine (CID 174784468) is (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine.
What is the SMILES notation for (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine?
The canonical SMILES for (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine is CCN(CC)CC.O=C(S)Sc1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine?
The InChIKey is NPMJQGGUBPGWDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrOS2.C6H15N/c8-5-1-3-6(4-2-5)11-7(9)10;1-4-7(5-2)6-3/h1-4H,(H,9,10);4-6H2,1-3H3.
What are the key properties of (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine?
(4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine has a molecular weight of 350.35 g/mol, XLogP of 4.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)sulfanylmethanethioic S-acid;N,N-diethylethanamine is sourced from PubChem (CID 174784468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).