C10H8F12O4S2 — CID 174784857
4-(difluoromethyl)-2,2,4,5-tetrafluorothiolane 1,1-dioxide;4-(difluoromethyl)-2,3,3,4-tetrafluorothiolane 1,1-dioxide (PubChem CID 174784857) has the molecular formula C10H8F12O4S2 and a molecular weight of 484.28 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,2,4,5-tetrafluorothiolane 1,1-dioxide;4-(difluoromethyl)-2,3,3,4-tetrafluorothiolane 1,1-dioxide.
| Compound Name | 4-(difluoromethyl)-2,2,4,5-tetrafluorothiolane 1,1-dioxide;4-(difluoromethyl)-2,3,3,4-tetrafluorothiolane 1,1-dioxide |
|---|---|
| PubChem CID | 174784857 |
| Molecular Formula | C10H8F12O4S2 |
| Molecular Weight | 484.28 g/mol |
| Exact Mass | 483.97 |
| IUPAC Name | 4-(difluoromethyl)-2,2,4,5-tetrafluorothiolane 1,1-dioxide;4-(difluoromethyl)-2,3,3,4-tetrafluorothiolane 1,1-dioxide |
| SMILES | O=S1(=O)C(F)C(F)(C(F)F)CC1(F)F.O=S1(=O)CC(F)(C(F)F)C(F)(F)C1F |
| InChI | InChI=1S/2C5H4F6O2S/c6-2(7)4(9)1-14(12,13)3(8)5(4,10)11;6-2(7)4(9)1-5(10,11)14(12,13)3(4)8/h2*2-3H,1H2 |
| InChIKey | OOLWQORSTCCEOO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |