C10H6F14O4S2 — CID 174784959
2,2,4,5-tetrafluoro-4-(trifluoromethyl)thiolane 1,1-dioxide;2,3,3,4-tetrafluoro-4-(trifluoromethyl)thiolane 1,1-dioxide (PubChem CID 174784959) has the molecular formula C10H6F14O4S2 and a molecular weight of 520.26 g/mol. Its IUPAC name is 2,2,4,5-tetrafluoro-4-(trifluoromethyl)thiolane 1,1-dioxide;2,3,3,4-tetrafluoro-4-(trifluoromethyl)thiolane 1,1-dioxide.
| Compound Name | 2,2,4,5-tetrafluoro-4-(trifluoromethyl)thiolane 1,1-dioxide;2,3,3,4-tetrafluoro-4-(trifluoromethyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 174784959 |
| Molecular Formula | C10H6F14O4S2 |
| Molecular Weight | 520.26 g/mol |
| Exact Mass | 519.95 |
| IUPAC Name | 2,2,4,5-tetrafluoro-4-(trifluoromethyl)thiolane 1,1-dioxide;2,3,3,4-tetrafluoro-4-(trifluoromethyl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)C(F)C(F)(C(F)(F)F)CC1(F)F.O=S1(=O)CC(F)(C(F)(F)F)C(F)(F)C1F |
| InChI | InChI=1S/2C5H3F7O2S/c6-2-4(8,9)3(7,5(10,11)12)1-15(2,13)14;6-2-3(7,5(10,11)12)1-4(8,9)15(2,13)14/h2*2H,1H2 |
| InChIKey | OJJRXFSVZMSKTL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |