About 2-pentoxypropanedial
2-pentoxypropanedial (PubChem CID 174785109) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-pentoxypropanedial.
Molecular Properties
| Compound Name | 2-pentoxypropanedial |
| PubChem CID | 174785109 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-pentoxypropanedial |
| SMILES | CCCCCOC(C=O)C=O |
| InChI | InChI=1S/C8H14O3/c1-2-3-4-5-11-8(6-9)7-10/h6-8H,2-5H2,1H3 |
| InChIKey | MDHDEKNTRSMPLW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-pentoxypropanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentoxypropanedial?
The IUPAC name of 2-pentoxypropanedial (CID 174785109) is 2-pentoxypropanedial.
What is the SMILES notation for 2-pentoxypropanedial?
The canonical SMILES for 2-pentoxypropanedial is CCCCCOC(C=O)C=O.
What is the InChIKey of 2-pentoxypropanedial?
The InChIKey is MDHDEKNTRSMPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-2-3-4-5-11-8(6-9)7-10/h6-8H,2-5H2,1H3.
What are the key properties of 2-pentoxypropanedial?
2-pentoxypropanedial has a molecular weight of 158.20 g/mol, XLogP of 0.96, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentoxypropanedial is sourced from PubChem (CID 174785109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).