C26H32N4O7S3 — CID 174785480
2,2,2-tris(3,5-dimethyl-4-sulfamoylphenyl)acetamide (PubChem CID 174785480) has the molecular formula C26H32N4O7S3 and a molecular weight of 608.76 g/mol. Its IUPAC name is 2,2,2-tris(3,5-dimethyl-4-sulfamoylphenyl)acetamide.
| Compound Name | 2,2,2-tris(3,5-dimethyl-4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 174785480 |
| Molecular Formula | C26H32N4O7S3 |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | 2,2,2-tris(3,5-dimethyl-4-sulfamoylphenyl)acetamide |
| SMILES | Cc1cc(C(C(N)=O)(c2cc(C)c(S(N)(=O)=O)c(C)c2)c2cc(C)c(S(N)(=O)=O)c(C)c2)cc(C)c1S(N)(=O)=O |
| InChI | InChI=1S/C26H32N4O7S3/c1-13-7-19(8-14(2)22(13)38(28,32)33)26(25(27)31,20-9-15(3)23(16(4)10-20)39(29,34)35)21-11-17(5)24(18(6)12-21)40(30,36)37/h7-12H,1-6H3,(H2,27,31)(H2,28,32,33)(H2,29,34,35)(H2,30,36,37) |
| InChIKey | ZOOKHXREKVCKAK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 223.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|