C21H19FN4O3 — CID 17478558
5-ethyl-5-(4-fluorophenyl)-3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione (PubChem CID 17478558) has the molecular formula C21H19FN4O3 and a molecular weight of 394.41 g/mol. Its IUPAC name is 5-ethyl-5-(4-fluorophenyl)-3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-5-(4-fluorophenyl)-3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17478558 |
| Molecular Formula | C21H19FN4O3 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5-ethyl-5-(4-fluorophenyl)-3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(Cc2nc(-c3ccccc3C)no2)C1=O |
| InChI | InChI=1S/C21H19FN4O3/c1-3-21(14-8-10-15(22)11-9-14)19(27)26(20(28)24-21)12-17-23-18(25-29-17)16-7-5-4-6-13(16)2/h4-11H,3,12H2,1-2H3,(H,24,28) |
| InChIKey | KHZZWWOLSALXSM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|