C21H36O3 — CID 174785733
3,7-dimethylocta-1,6-dien-3-yl [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonate (PubChem CID 174785733) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yl [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonate.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yl [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonate |
|---|---|
| PubChem CID | 174785733 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yl [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonate |
| SMILES | C=CC(C)(CCC=C(C)C)OC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C21H36O3/c1-8-21(7,13-9-10-15(2)3)24-20(22)23-19-14-17(6)11-12-18(19)16(4)5/h8,10,16-19H,1,9,11-14H2,2-7H3/t17-,18+,19-,21?/m1/s1 |
| InChIKey | NBDNCBBDICDPBP-HQPYMTOTSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|