About lithium;formyl 2,2-dimethylpropanoate;hydride
lithium;formyl 2,2-dimethylpropanoate;hydride (PubChem CID 174785944) has the molecular formula C6H11LiO3
and a molecular weight of 138.09 g/mol. Its IUPAC name is lithium;formyl 2,2-dimethylpropanoate;hydride.
Molecular Properties
| Compound Name | lithium;formyl 2,2-dimethylpropanoate;hydride |
| PubChem CID | 174785944 |
| Molecular Formula | C6H11LiO3 |
| Molecular Weight | 138.09 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | lithium;formyl 2,2-dimethylpropanoate;hydride |
| SMILES | CC(C)(C)C(=O)OC=O.[H-].[Li+] |
| InChI | InChI=1S/C6H10O3.Li.H/c1-6(2,3)5(8)9-4-7;;/h4H,1-3H3;;/q;+1;-1 |
| InChIKey | YMINANKNOINNEX-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.09 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze lithium;formyl 2,2-dimethylpropanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;formyl 2,2-dimethylpropanoate;hydride?
The IUPAC name of lithium;formyl 2,2-dimethylpropanoate;hydride (CID 174785944) is lithium;formyl 2,2-dimethylpropanoate;hydride.
What is the SMILES notation for lithium;formyl 2,2-dimethylpropanoate;hydride?
The canonical SMILES for lithium;formyl 2,2-dimethylpropanoate;hydride is CC(C)(C)C(=O)OC=O.[H-].[Li+].
What is the InChIKey of lithium;formyl 2,2-dimethylpropanoate;hydride?
The InChIKey is YMINANKNOINNEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.Li.H/c1-6(2,3)5(8)9-4-7;;/h4H,1-3H3;;/q;+1;-1.
What are the key properties of lithium;formyl 2,2-dimethylpropanoate;hydride?
lithium;formyl 2,2-dimethylpropanoate;hydride has a molecular weight of 138.09 g/mol, XLogP of -2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;formyl 2,2-dimethylpropanoate;hydride is sourced from PubChem (CID 174785944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).