C18H14FNO8S2 — CID 174786291
5-fluoro-1-(4-methylphenyl)sulfonyl-3-thiophen-2-yl-3H-pyrrole-2,2,4-tricarboxylic acid (PubChem CID 174786291) has the molecular formula C18H14FNO8S2 and a molecular weight of 455.44 g/mol. Its IUPAC name is 5-fluoro-1-(4-methylphenyl)sulfonyl-3-thiophen-2-yl-3H-pyrrole-2,2,4-tricarboxylic acid.
| Compound Name | 5-fluoro-1-(4-methylphenyl)sulfonyl-3-thiophen-2-yl-3H-pyrrole-2,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 174786291 |
| Molecular Formula | C18H14FNO8S2 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | 5-fluoro-1-(4-methylphenyl)sulfonyl-3-thiophen-2-yl-3H-pyrrole-2,2,4-tricarboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2C(F)=C(C(=O)O)C(c3cccs3)C2(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H14FNO8S2/c1-9-4-6-10(7-5-9)30(27,28)20-14(19)12(15(21)22)13(11-3-2-8-29-11)18(20,16(23)24)17(25)26/h2-8,13H,1H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | YDUGOOGSCIQLRP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|