C18H20FNO8S — CID 174786367
5-fluoro-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)-3H-pyrrole-2,2,4-tricarboxylic acid (PubChem CID 174786367) has the molecular formula C18H20FNO8S and a molecular weight of 429.42 g/mol. Its IUPAC name is 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)-3H-pyrrole-2,2,4-tricarboxylic acid.
| Compound Name | 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)-3H-pyrrole-2,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 174786367 |
| Molecular Formula | C18H20FNO8S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)-3H-pyrrole-2,2,4-tricarboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2C(F)=C(C(=O)O)C(CC(C)C)C2(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H20FNO8S/c1-9(2)8-12-13(15(21)22)14(19)20(18(12,16(23)24)17(25)26)29(27,28)11-6-4-10(3)5-7-11/h4-7,9,12H,8H2,1-3H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | FAMMFQAJAPRSTB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|