C8H11F3N4O3 — CID 174786419
1-[2,6-diamino-5-(trifluoromethyl)pyrimidin-4-yl]oxypropane-1,2-diol (PubChem CID 174786419) has the molecular formula C8H11F3N4O3 and a molecular weight of 268.19 g/mol. Its IUPAC name is 1-[2,6-diamino-5-(trifluoromethyl)pyrimidin-4-yl]oxypropane-1,2-diol.
| Compound Name | 1-[2,6-diamino-5-(trifluoromethyl)pyrimidin-4-yl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 174786419 |
| Molecular Formula | C8H11F3N4O3 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-[2,6-diamino-5-(trifluoromethyl)pyrimidin-4-yl]oxypropane-1,2-diol |
| SMILES | CC(O)C(O)Oc1nc(N)nc(N)c1C(F)(F)F |
| InChI | InChI=1S/C8H11F3N4O3/c1-2(16)6(17)18-5-3(8(9,10)11)4(12)14-7(13)15-5/h2,6,16-17H,1H3,(H4,12,13,14,15) |
| InChIKey | NRABZUOQPXQRHL-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|