C27H21N9 — CID 174786446
1,3,5-tris(azidomethyl)-2,4,6-triphenylbenzene (PubChem CID 174786446) has the molecular formula C27H21N9 and a molecular weight of 471.53 g/mol. Its IUPAC name is 1,3,5-tris(azidomethyl)-2,4,6-triphenylbenzene.
| Compound Name | 1,3,5-tris(azidomethyl)-2,4,6-triphenylbenzene |
|---|---|
| PubChem CID | 174786446 |
| Molecular Formula | C27H21N9 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 1,3,5-tris(azidomethyl)-2,4,6-triphenylbenzene |
| SMILES | [N-]=[N+]=NCc1c(-c2ccccc2)c(CN=[N+]=[N-])c(-c2ccccc2)c(CN=[N+]=[N-])c1-c1ccccc1 |
| InChI | InChI=1S/C27H21N9/c28-34-31-16-22-25(19-10-4-1-5-11-19)23(17-32-35-29)27(21-14-8-3-9-15-21)24(18-33-36-30)26(22)20-12-6-2-7-13-20/h1-15H,16-18H2 |
| InChIKey | QZHZPOMZFYJRLF-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 146.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|