C15H18O4P+ — CID 174787192
2-hydroxy-5,5-dimethyl-2-naphthalen-2-yloxy-1,3,2-dioxaphosphinan-2-ium (PubChem CID 174787192) has the molecular formula C15H18O4P+ and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-hydroxy-5,5-dimethyl-2-naphthalen-2-yloxy-1,3,2-dioxaphosphinan-2-ium.
| Compound Name | 2-hydroxy-5,5-dimethyl-2-naphthalen-2-yloxy-1,3,2-dioxaphosphinan-2-ium |
|---|---|
| PubChem CID | 174787192 |
| Molecular Formula | C15H18O4P+ |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-hydroxy-5,5-dimethyl-2-naphthalen-2-yloxy-1,3,2-dioxaphosphinan-2-ium |
| SMILES | CC1(C)CO[P+](O)(Oc2ccc3ccccc3c2)OC1 |
| InChI | InChI=1S/C15H18O4P/c1-15(2)10-17-20(16,18-11-15)19-14-8-7-12-5-3-4-6-13(12)9-14/h3-9,16H,10-11H2,1-2H3/q+1 |
| InChIKey | PDWJUTCCSWODBX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|