C12H18N4 — CID 174787379
5-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)tetrazine (PubChem CID 174787379) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)tetrazine.
| Compound Name | 5-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)tetrazine |
|---|---|
| PubChem CID | 174787379 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 5-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)tetrazine |
| SMILES | c1nnnnc1C1CCCC2CCCCC21 |
| InChI | InChI=1S/C12H18N4/c1-2-6-10-9(4-1)5-3-7-11(10)12-8-13-15-16-14-12/h8-11H,1-7H2 |
| InChIKey | NNUCDPIJZKLOPW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |