About 1-morpholin-3-yl-2,3-dihydropyridin-6-one
1-morpholin-3-yl-2,3-dihydropyridin-6-one (PubChem CID 174787409) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-morpholin-3-yl-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-morpholin-3-yl-2,3-dihydropyridin-6-one |
| PubChem CID | 174787409 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-morpholin-3-yl-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1C1COCCN1 |
| InChI | InChI=1S/C9H14N2O2/c12-9-3-1-2-5-11(9)8-7-13-6-4-10-8/h1,3,8,10H,2,4-7H2 |
| InChIKey | WFRAROZGCYTTST-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-morpholin-3-yl-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-3-yl-2,3-dihydropyridin-6-one?
The IUPAC name of 1-morpholin-3-yl-2,3-dihydropyridin-6-one (CID 174787409) is 1-morpholin-3-yl-2,3-dihydropyridin-6-one.
What is the SMILES notation for 1-morpholin-3-yl-2,3-dihydropyridin-6-one?
The canonical SMILES for 1-morpholin-3-yl-2,3-dihydropyridin-6-one is O=C1C=CCCN1C1COCCN1.
What is the InChIKey of 1-morpholin-3-yl-2,3-dihydropyridin-6-one?
The InChIKey is WFRAROZGCYTTST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c12-9-3-1-2-5-11(9)8-7-13-6-4-10-8/h1,3,8,10H,2,4-7H2.
What are the key properties of 1-morpholin-3-yl-2,3-dihydropyridin-6-one?
1-morpholin-3-yl-2,3-dihydropyridin-6-one has a molecular weight of 182.22 g/mol, XLogP of -0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-3-yl-2,3-dihydropyridin-6-one is sourced from PubChem (CID 174787409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).