About methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate
methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate (PubChem CID 174788153) has the molecular formula C14H22O6
and a molecular weight of 286.32 g/mol. Its IUPAC name is methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate |
| PubChem CID | 174788153 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate |
| SMILES | C=C(CC(C)O)C(=O)OC.C=C(CC1CO1)C(=O)OC |
| InChI | InChI=1S/C7H10O3.C7H12O3/c1-5(7(8)9-2)3-6-4-10-6;1-5(4-6(2)8)7(9)10-3/h6H,1,3-4H2,2H3;6,8H,1,4H2,2-3H3 |
| InChIKey | LBYXYJGEDWCGQD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate?
The IUPAC name of methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate (CID 174788153) is methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate.
What is the SMILES notation for methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate?
The canonical SMILES for methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate is C=C(CC(C)O)C(=O)OC.C=C(CC1CO1)C(=O)OC.
What is the InChIKey of methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate?
The InChIKey is LBYXYJGEDWCGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.C7H12O3/c1-5(7(8)9-2)3-6-4-10-6;1-5(4-6(2)8)7(9)10-3/h6H,1,3-4H2,2H3;6,8H,1,4H2,2-3H3.
What are the key properties of methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate?
methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate has a molecular weight of 286.32 g/mol, XLogP of 0.99, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxy-2-methylidenepentanoate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate is sourced from PubChem (CID 174788153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).