About 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane
2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane (PubChem CID 174788329) has the molecular formula C19H36O3Si
and a molecular weight of 340.58 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane.
Molecular Properties
| Compound Name | 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane |
| PubChem CID | 174788329 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane |
| SMILES | CCOC1(CCC2=CCCCC2)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C19H36O3Si/c1-4-20-19(16-14-18-12-8-7-9-13-18)15-10-11-17-23(19,21-5-2)22-6-3/h12H,4-11,13-17H2,1-3H3 |
| InChIKey | UHSPZPPHJAXJQD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane?
The IUPAC name of 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane (CID 174788329) is 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane.
What is the SMILES notation for 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane?
The canonical SMILES for 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane is CCOC1(CCC2=CCCCC2)CCCC[Si]1(OCC)OCC.
What is the InChIKey of 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane?
The InChIKey is UHSPZPPHJAXJQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O3Si/c1-4-20-19(16-14-18-12-8-7-9-13-18)15-10-11-17-23(19,21-5-2)22-6-3/h12H,4-11,13-17H2,1-3H3.
What are the key properties of 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane?
2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane has a molecular weight of 340.58 g/mol, XLogP of 5.28, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(cyclohexen-1-yl)ethyl]-1,1,2-triethoxysilinane is sourced from PubChem (CID 174788329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).