About 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine
4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine (PubChem CID 174788371) has the molecular formula C25H29NO2
and a molecular weight of 375.51 g/mol. Its IUPAC name is 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine.
Molecular Properties
| Compound Name | 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine |
| PubChem CID | 174788371 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine |
| SMILES | CCC1C=CC=C[C@@]1(c1ccncc1)c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C25H29NO2/c1-3-19-8-6-7-15-25(19,20-13-16-26-17-14-20)21-11-12-23(27-2)24(18-21)28-22-9-4-5-10-22/h6-8,11-19,22H,3-5,9-10H2,1-2H3/t19?,25-/m1/s1 |
| InChIKey | SEZSCYIUQGFCEL-OPEAARRCSA-N |
| XLogP | 5.85 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine?
The IUPAC name of 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine (CID 174788371) is 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine.
What is the SMILES notation for 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine?
The canonical SMILES for 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine is CCC1C=CC=C[C@@]1(c1ccncc1)c1ccc(OC)c(OC2CCCC2)c1.
What is the InChIKey of 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine?
The InChIKey is SEZSCYIUQGFCEL-OPEAARRCSA-N. The full InChI is InChI=1S/C25H29NO2/c1-3-19-8-6-7-15-25(19,20-13-16-26-17-14-20)21-11-12-23(27-2)24(18-21)28-22-9-4-5-10-22/h6-8,11-19,22H,3-5,9-10H2,1-2H3/t19?,25-/m1/s1.
What are the key properties of 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine?
4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine has a molecular weight of 375.51 g/mol, XLogP of 5.85, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-6-ethylcyclohexa-2,4-dien-1-yl]pyridine is sourced from PubChem (CID 174788371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).