C14H10F7NO3 — CID 174788683
5-ethoxy-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole-3-carboxylic acid (PubChem CID 174788683) has the molecular formula C14H10F7NO3 and a molecular weight of 373.22 g/mol. Its IUPAC name is 5-ethoxy-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole-3-carboxylic acid.
| Compound Name | 5-ethoxy-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 174788683 |
| Molecular Formula | C14H10F7NO3 |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 5-ethoxy-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole-3-carboxylic acid |
| SMILES | CCOc1ccc2[nH]c(C(F)(F)C(F)(F)C(F)(F)F)c(C(=O)O)c2c1 |
| InChI | InChI=1S/C14H10F7NO3/c1-2-25-6-3-4-8-7(5-6)9(11(23)24)10(22-8)12(15,16)13(17,18)14(19,20)21/h3-5,22H,2H2,1H3,(H,23,24) |
| InChIKey | ZWZMMHVWSVNCAS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|