About benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol
benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol (PubChem CID 174790535) has the molecular formula C13H21BN2O6
and a molecular weight of 312.13 g/mol. Its IUPAC name is benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol.
Molecular Properties
| Compound Name | benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol |
| PubChem CID | 174790535 |
| Molecular Formula | C13H21BN2O6 |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol |
| SMILES | CC(C)(O)C(C)(C)O.O=C1N=c2ccccc2=N1.OB(O)O |
| InChI | InChI=1S/C7H4N2O.C6H14O2.BH3O3/c10-7-8-5-3-1-2-4-6(5)9-7;1-5(2,7)6(3,4)8;2-1(3)4/h1-4H;7-8H,1-4H3;2-4H |
| InChIKey | DEYXFNQAPGJNQS-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 142.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol?
The IUPAC name of benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol (CID 174790535) is benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol.
What is the SMILES notation for benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol?
The canonical SMILES for benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol is CC(C)(O)C(C)(C)O.O=C1N=c2ccccc2=N1.OB(O)O.
What is the InChIKey of benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol?
The InChIKey is DEYXFNQAPGJNQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O.C6H14O2.BH3O3/c10-7-8-5-3-1-2-4-6(5)9-7;1-5(2,7)6(3,4)8;2-1(3)4/h1-4H;7-8H,1-4H3;2-4H.
What are the key properties of benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol?
benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol has a molecular weight of 312.13 g/mol, XLogP of -1.46, 1 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzimidazol-2-one;boric acid;2,3-dimethylbutane-2,3-diol is sourced from PubChem (CID 174790535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).