About copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid
copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid (PubChem CID 174790659) has the molecular formula C19H18CuO2
and a molecular weight of 341.90 g/mol. Its IUPAC name is copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid.
Molecular Properties
| Compound Name | copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid |
| PubChem CID | 174790659 |
| Molecular Formula | C19H18CuO2 |
| Molecular Weight | 341.90 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid |
| SMILES | Cc1ccc2c(ccc3cc(C(C)C)ccc32)c1C(=O)O.[Cu] |
| InChI | InChI=1S/C19H18O2.Cu/c1-11(2)13-5-8-15-14(10-13)6-9-17-16(15)7-4-12(3)18(17)19(20)21;/h4-11H,1-3H3,(H,20,21); |
| InChIKey | BUNJQIIIMVPXFC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.90 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid?
The IUPAC name of copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid (CID 174790659) is copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid.
What is the SMILES notation for copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid?
The canonical SMILES for copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid is Cc1ccc2c(ccc3cc(C(C)C)ccc32)c1C(=O)O.[Cu].
What is the InChIKey of copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid?
The InChIKey is BUNJQIIIMVPXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O2.Cu/c1-11(2)13-5-8-15-14(10-13)6-9-17-16(15)7-4-12(3)18(17)19(20)21;/h4-11H,1-3H3,(H,20,21);.
What are the key properties of copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid?
copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid has a molecular weight of 341.90 g/mol, XLogP of 5.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-methyl-7-propan-2-ylphenanthrene-1-carboxylic acid is sourced from PubChem (CID 174790659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).