About 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide
2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide (PubChem CID 174791038) has the molecular formula C16H21BrN2
and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide.
Molecular Properties
| Compound Name | 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide |
| PubChem CID | 174791038 |
| Molecular Formula | C16H21BrN2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide |
| SMILES | Br.CCCCCN1C=C2N=c3ccccc3=C2CC1 |
| InChI | InChI=1S/C16H20N2.BrH/c1-2-3-6-10-18-11-9-14-13-7-4-5-8-15(13)17-16(14)12-18;/h4-5,7-8,12H,2-3,6,9-11H2,1H3;1H |
| InChIKey | LRLQPRFPAMQWFZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide?
The IUPAC name of 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide (CID 174791038) is 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide.
What is the SMILES notation for 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide?
The canonical SMILES for 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide is Br.CCCCCN1C=C2N=c3ccccc3=C2CC1.
What is the InChIKey of 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide?
The InChIKey is LRLQPRFPAMQWFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2.BrH/c1-2-3-6-10-18-11-9-14-13-7-4-5-8-15(13)17-16(14)12-18;/h4-5,7-8,12H,2-3,6,9-11H2,1H3;1H.
What are the key properties of 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide?
2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide has a molecular weight of 321.26 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-3,4-dihydropyrido[3,4-b]indole;hydrobromide is sourced from PubChem (CID 174791038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).