About sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride
sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride (PubChem CID 174791181) has the molecular formula C3H4NNaS2
and a molecular weight of 141.20 g/mol. Its IUPAC name is sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride.
Molecular Properties
| Compound Name | sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride |
| PubChem CID | 174791181 |
| Molecular Formula | C3H4NNaS2 |
| Molecular Weight | 141.20 g/mol |
| Exact Mass | 140.97 |
| IUPAC Name | sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride |
| SMILES | N#CC=C(S)S.[H-].[Na+] |
| InChI | InChI=1S/C3H3NS2.Na.H/c4-2-1-3(5)6;;/h1,5-6H;;/q;+1;-1 |
| InChIKey | ANAZJRVQSFCDSH-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.20 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride?
The IUPAC name of sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride (CID 174791181) is sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride.
What is the SMILES notation for sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride?
The canonical SMILES for sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride is N#CC=C(S)S.[H-].[Na+].
What is the InChIKey of sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride?
The InChIKey is ANAZJRVQSFCDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3NS2.Na.H/c4-2-1-3(5)6;;/h1,5-6H;;/q;+1;-1.
What are the key properties of sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride?
sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride has a molecular weight of 141.20 g/mol, XLogP of -1.67, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3,3-bis(sulfanyl)prop-2-enenitrile;hydride is sourced from PubChem (CID 174791181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).