About 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride
5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride (PubChem CID 174791441) has the molecular formula C7H15Cl2N
and a molecular weight of 184.11 g/mol. Its IUPAC name is 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride |
| PubChem CID | 174791441 |
| Molecular Formula | C7H15Cl2N |
| Molecular Weight | 184.11 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride |
| SMILES | C=CC(CCCl)N(C)C.Cl |
| InChI | InChI=1S/C7H14ClN.ClH/c1-4-7(5-6-8)9(2)3;/h4,7H,1,5-6H2,2-3H3;1H |
| InChIKey | VIAFLXPKFPYMOC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.11 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride?
The IUPAC name of 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride (CID 174791441) is 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride.
What is the SMILES notation for 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride?
The canonical SMILES for 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride is C=CC(CCCl)N(C)C.Cl.
What is the InChIKey of 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride?
The InChIKey is VIAFLXPKFPYMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClN.ClH/c1-4-7(5-6-8)9(2)3;/h4,7H,1,5-6H2,2-3H3;1H.
What are the key properties of 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride?
5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride has a molecular weight of 184.11 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N,N-dimethylpent-1-en-3-amine;hydrochloride is sourced from PubChem (CID 174791441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).