About propan-2-ol;tantalum
propan-2-ol;tantalum (PubChem CID 174791466) has the molecular formula C3H7OTa-
and a molecular weight of 240.04 g/mol. Its IUPAC name is propan-2-ol;tantalum.
Molecular Properties
| Compound Name | propan-2-ol;tantalum |
| PubChem CID | 174791466 |
| Molecular Formula | C3H7OTa- |
| Molecular Weight | 240.04 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | propan-2-ol;tantalum |
| SMILES | C[C-](C)O.[Ta] |
| InChI | InChI=1S/C3H7O.Ta/c1-3(2)4;/h4H,1-2H3;/q-1; |
| InChIKey | VDEJTUBWPYKXEH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.04 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ol;tantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;tantalum?
The IUPAC name of propan-2-ol;tantalum (CID 174791466) is propan-2-ol;tantalum.
What is the SMILES notation for propan-2-ol;tantalum?
The canonical SMILES for propan-2-ol;tantalum is C[C-](C)O.[Ta].
What is the InChIKey of propan-2-ol;tantalum?
The InChIKey is VDEJTUBWPYKXEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O.Ta/c1-3(2)4;/h4H,1-2H3;/q-1;.
What are the key properties of propan-2-ol;tantalum?
propan-2-ol;tantalum has a molecular weight of 240.04 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;tantalum is sourced from PubChem (CID 174791466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).