C29H28F3NO13 — CID 174792162
[[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]amino] 2,2,2-trifluoroacetate (PubChem CID 174792162) has the molecular formula C29H28F3NO13 and a molecular weight of 655.53 g/mol. Its IUPAC name is [[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174792162 |
| Molecular Formula | C29H28F3NO13 |
| Molecular Weight | 655.53 g/mol |
| Exact Mass | 655.15 |
| IUPAC Name | [[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]amino] 2,2,2-trifluoroacetate |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)CO)C[C@@H]3OC1CC(NOC(=O)C(F)(F)F)C(O)C(C)O1 |
| InChI | InChI=1S/C29H28F3NO13/c1-10-22(36)13(33-46-27(41)29(30,31)32)6-17(44-10)45-15-8-28(42,16(35)9-34)7-12-19(15)26(40)21-20(24(12)38)23(37)11-4-3-5-14(43-2)18(11)25(21)39/h3-5,10,13,15,17,22,33-34,36,38,40,42H,6-9H2,1-2H3/t10?,13?,15-,17?,22?,28-/m0/s1 |
| InChIKey | CNHVLTHROAYTJY-WCGDISBRSA-N |
| XLogP | 0.65 |
| TPSA | 218.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.53 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|