About ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol
ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol (PubChem CID 174792194) has the molecular formula C8H20N2O3
and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol.
Molecular Properties
| Compound Name | ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol |
| PubChem CID | 174792194 |
| Molecular Formula | C8H20N2O3 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol |
| SMILES | NCCN.OCC1CCC(CO)O1 |
| InChI | InChI=1S/C6H12O3.C2H8N2/c7-3-5-1-2-6(4-8)9-5;3-1-2-4/h5-8H,1-4H2;1-4H2 |
| InChIKey | GLSKNYQVIQGUEA-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol?
The IUPAC name of ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol (CID 174792194) is ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol.
What is the SMILES notation for ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol?
The canonical SMILES for ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol is NCCN.OCC1CCC(CO)O1.
What is the InChIKey of ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol?
The InChIKey is GLSKNYQVIQGUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C2H8N2/c7-3-5-1-2-6(4-8)9-5;3-1-2-4/h5-8H,1-4H2;1-4H2.
What are the key properties of ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol?
ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol has a molecular weight of 192.26 g/mol, XLogP of -1.58, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diamine;[5-(hydroxymethyl)oxolan-2-yl]methanol is sourced from PubChem (CID 174792194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).