C8H13NO — CID 174792221
2,3,3a,4,5,6-hexahydro-1H-indol-3-ol (PubChem CID 174792221) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 2,3,3a,4,5,6-hexahydro-1H-indol-3-ol.
| Compound Name | 2,3,3a,4,5,6-hexahydro-1H-indol-3-ol |
|---|---|
| PubChem CID | 174792221 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2,3,3a,4,5,6-hexahydro-1H-indol-3-ol |
| SMILES | OC1CNC2=CCCCC21 |
| InChI | InChI=1S/C8H13NO/c10-8-5-9-7-4-2-1-3-6(7)8/h4,6,8-10H,1-3,5H2 |
| InChIKey | BKQNKSIFYNCFGO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |