C10H22N2O2 — CID 174792738
1-hexylpiperazine-2,3-diol (PubChem CID 174792738) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-hexylpiperazine-2,3-diol.
| Compound Name | 1-hexylpiperazine-2,3-diol |
|---|---|
| PubChem CID | 174792738 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-hexylpiperazine-2,3-diol |
| SMILES | CCCCCCN1CCNC(O)C1O |
| InChI | InChI=1S/C10H22N2O2/c1-2-3-4-5-7-12-8-6-11-9(13)10(12)14/h9-11,13-14H,2-8H2,1H3 |
| InChIKey | SGCTVQYWHOUHGR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|