About 2-methylbut-2-ene;tricyclohexylphosphane
2-methylbut-2-ene;tricyclohexylphosphane (PubChem CID 174792774) has the molecular formula C23H43P
and a molecular weight of 350.57 g/mol. Its IUPAC name is 2-methylbut-2-ene;tricyclohexylphosphane.
Molecular Properties
| Compound Name | 2-methylbut-2-ene;tricyclohexylphosphane |
| PubChem CID | 174792774 |
| Molecular Formula | C23H43P |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.31 |
| IUPAC Name | 2-methylbut-2-ene;tricyclohexylphosphane |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.CC=C(C)C |
| InChI | InChI=1S/C18H33P.C5H10/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-5(2)3/h16-18H,1-15H2;4H,1-3H3 |
| InChIKey | VQFCMIBBAZHGLU-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-2-ene;tricyclohexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-2-ene;tricyclohexylphosphane?
The IUPAC name of 2-methylbut-2-ene;tricyclohexylphosphane (CID 174792774) is 2-methylbut-2-ene;tricyclohexylphosphane.
What is the SMILES notation for 2-methylbut-2-ene;tricyclohexylphosphane?
The canonical SMILES for 2-methylbut-2-ene;tricyclohexylphosphane is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.CC=C(C)C.
What is the InChIKey of 2-methylbut-2-ene;tricyclohexylphosphane?
The InChIKey is VQFCMIBBAZHGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33P.C5H10/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-5(2)3/h16-18H,1-15H2;4H,1-3H3.
What are the key properties of 2-methylbut-2-ene;tricyclohexylphosphane?
2-methylbut-2-ene;tricyclohexylphosphane has a molecular weight of 350.57 g/mol, XLogP of 8.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-ene;tricyclohexylphosphane is sourced from PubChem (CID 174792774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).