About dichloronickel;N,N-dimethylformamide
dichloronickel;N,N-dimethylformamide (PubChem CID 174793143) has the molecular formula C3H7Cl2NNiO
and a molecular weight of 202.69 g/mol. Its IUPAC name is dichloronickel;N,N-dimethylformamide.
Molecular Properties
| Compound Name | dichloronickel;N,N-dimethylformamide |
| PubChem CID | 174793143 |
| Molecular Formula | C3H7Cl2NNiO |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 200.93 |
| IUPAC Name | dichloronickel;N,N-dimethylformamide |
| SMILES | CN(C)C=O.Cl[Ni]Cl |
| InChI | InChI=1S/C3H7NO.2ClH.Ni/c1-4(2)3-5;;;/h3H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | MJUOJEAMSYVWBU-UHFFFAOYSA-L |
| XLogP | 1.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel;N,N-dimethylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel;N,N-dimethylformamide?
The IUPAC name of dichloronickel;N,N-dimethylformamide (CID 174793143) is dichloronickel;N,N-dimethylformamide.
What is the SMILES notation for dichloronickel;N,N-dimethylformamide?
The canonical SMILES for dichloronickel;N,N-dimethylformamide is CN(C)C=O.Cl[Ni]Cl.
What is the InChIKey of dichloronickel;N,N-dimethylformamide?
The InChIKey is MJUOJEAMSYVWBU-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H7NO.2ClH.Ni/c1-4(2)3-5;;;/h3H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichloronickel;N,N-dimethylformamide?
dichloronickel;N,N-dimethylformamide has a molecular weight of 202.69 g/mol, XLogP of 1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel;N,N-dimethylformamide is sourced from PubChem (CID 174793143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).