C12H15ClFNO2 — CID 174793655
[(3-chloro-2-fluorophenyl)methylamino] 2,2-dimethylpropanoate (PubChem CID 174793655) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is [(3-chloro-2-fluorophenyl)methylamino] 2,2-dimethylpropanoate.
| Compound Name | [(3-chloro-2-fluorophenyl)methylamino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174793655 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [(3-chloro-2-fluorophenyl)methylamino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ONCc1cccc(Cl)c1F |
| InChI | InChI=1S/C12H15ClFNO2/c1-12(2,3)11(16)17-15-7-8-5-4-6-9(13)10(8)14/h4-6,15H,7H2,1-3H3 |
| InChIKey | KCQYJPPLTFQXOH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|