About (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate
(4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate (PubChem CID 174793712) has the molecular formula C14H13F3N2O4S
and a molecular weight of 362.33 g/mol. Its IUPAC name is (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate |
| PubChem CID | 174793712 |
| Molecular Formula | C14H13F3N2O4S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate |
| SMILES | Cc1cnn(OC(=O)c2ccc(C(F)(F)F)cc2S(C)(=O)=O)c1C |
| InChI | InChI=1S/C14H13F3N2O4S/c1-8-7-18-19(9(8)2)23-13(20)11-5-4-10(14(15,16)17)6-12(11)24(3,21)22/h4-7H,1-3H3 |
| InChIKey | HOPMUOMKXMBXTG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate?
The IUPAC name of (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate (CID 174793712) is (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate.
What is the SMILES notation for (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate?
The canonical SMILES for (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate is Cc1cnn(OC(=O)c2ccc(C(F)(F)F)cc2S(C)(=O)=O)c1C.
What is the InChIKey of (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate?
The InChIKey is HOPMUOMKXMBXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N2O4S/c1-8-7-18-19(9(8)2)23-13(20)11-5-4-10(14(15,16)17)6-12(11)24(3,21)22/h4-7H,1-3H3.
What are the key properties of (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate?
(4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate has a molecular weight of 362.33 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethylpyrazol-1-yl) 2-methylsulfonyl-4-(trifluoromethyl)benzoate is sourced from PubChem (CID 174793712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).